Urolithin B (1139-83-9) Үйлдвэрлэгч үйлдвэр

Уролитин В

Арваннэгдүгээр 9, 2020

Urolithin BSтохируулга

нэр: Уролитин В
Химийн нэр: 3-Hydroxy-6H-dibenzo [b, d] пиран-6-нэг
CAS: 1139-83-9
Химийн томъёо: C13H8O3
Молекулын жин: 212.2 г / моль
өнгө:  Цагаан нунтаг
ИнЧи түлхүүр: WXUQMTRHPNOXBV-UHFFFAOYSA-N нь
SMILES код: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Чиг үүрэг: Urolithin B нь митохондри болон булчингийн үйл ажиллагааг сайжруулж чаддаг.

Уролитин В нь хөгшрөлтийн үед булчингийн хүч чадал, тэсвэр тэвчээрийг сайжруулдаг.

Хэрэглээ: Уролитин В нь эллагитанни гэдэсний гэдэсний бичил биетний метаболит бөгөөд шинжилгээний систем, нөхцөл байдлаас шалтгаалан исэлдүүлэгч ба про-исэлдүүлэгч бодисын хүчтэй идэвхийг үзүүлдэг. Urolithin B нь мөн эстроген болон / эсвэл эстроген дааврын эсрэг үйл ажиллагааг үзүүлж чаддаг.
Давхар байдал: N, N-диметилформамид ба диметилметиленээр амархан уусдаг. Сульфон, метанол, этанол, этил ацетатад бага зэрэг уусдаг
Хадгалах хугацаа: Hygroscopic, -20 ° C хөлдөөгч, идэвхгүй орчинд
Тээврийн байдал: Аюулгүй химийн бодисоор хүрээлэн буй орчны температурт зөөвөрлөнө. Энэ бүтээгдэхүүн нь ердийн тээвэрлэлт, гаалийн цагт хэдэн долоо хоногийн турш хангалттай тогтвортой байна.